| Name | (2-METHYL-4-PHENYLQUINOLIN-3-YL)ACETIC ACID HYDROCHLORIDE |
| Synonyms | (2-methyl-4-phenylquinolin-3-yl)acetate 3-Quinolineacetic acid, 2-methyl-4-phenyl- (2-methyl-4-phenylquinolinium-3-yl)acetate (2-methyl-4-phenylquinolin-3-yl)acetic acid (2-Methyl-4-phenyl-quinolin-3-yl)-aceticacid (2-METHYL-4-PHENYLQUINOLIN-3-YL)ACETIC ACID HYDROCHLORIDE 2-(2-Methyl-4-phenylquinolin-3-yl)acetic acid hydrochloride |
| CAS | 17401-15-9 |
| InChI | InChI=1/C18H15NO2/c1-12-15(11-17(20)21)18(13-7-3-2-4-8-13)14-9-5-6-10-16(14)19-12/h2-10H,11H2,1H3,(H,20,21)/p-1 |
| Molecular Formula | C18H15NO2 |
| Molar Mass | 277.32 |
| Boling Point | 470.6°C at 760 mmHg |
| Flash Point | 238.4°C |
| Vapor Presure | 1.17E-09mmHg at 25°C |
| Storage Condition | Room Temprature |
| Risk Codes | 20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| HS Code | 29334900 |